Products 2287315-28-8
CAS 2287315-28-8 is the registry number for 3-((6-Bromo-1H-benzo[d][1,2,3]triazol-1-yl)methyl)tetrahydro-2H-thiopyran 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(6-bromobenzotriazol-1-yl)methyl]thiane 1,1-dioxide (CAS 2287315-28-8) is a chemical compound with the molecular formula C12H14BrN3O2S and a molecular weight of 344.23 g/mol. IUPAC name: 3-[(6-bromobenzotriazol-1-yl)methyl]thiane 1,1-dioxide. InChIKey: MRTQYQIWJKVGII-UHFFFAOYSA-N.
| Molecular formula | C12H14BrN3O2S |
|---|---|
| Molecular weight | 344.23 g/mol |
| IUPAC name | 3-[(6-bromobenzotriazol-1-yl)methyl]thiane 1,1-dioxide |
| InChIKey | MRTQYQIWJKVGII-UHFFFAOYSA-N |
| SMILES | C1CC(CS(=O)(=O)C1)CN2C3=C(C=CC(=C3)Br)N=N2 |
Computed by PubChem (NCBI)