CAS 1187385-81-4 is the registry number for 2-(5-Bromopyridin-3-yl)-5-propyl-1,3,4-oxadiazole, 98%. Offered by: Combi-blocks. Available pack sizes: 100g, 1g, 25g, 10g, 5g.
2-(5-bromo-3-pyridinyl)-5-propyl-1,3,4-oxadiazole (CAS 1187385-81-4) is a chemical compound with the molecular formula C10H10BrN3O and a molecular weight of 268.11 g/mol. IUPAC name: 2-(5-bromo-3-pyridinyl)-5-propyl-1,3,4-oxadiazole. InChIKey: NXCRQOJMGOGZLB-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN3O |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | 2-(5-bromo-3-pyridinyl)-5-propyl-1,3,4-oxadiazole |
| InChIKey | NXCRQOJMGOGZLB-UHFFFAOYSA-N |
| SMILES | CCCC1=NN=C(O1)C2=CC(=CN=C2)Br |
Computed by PubChem (NCBI)