CAS 1341130-08-2 is the registry number for [3-(2-Bromobenzyl)-1,2,4-oxadiazol-5-yl]methanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[3-[(2-bromophenyl)methyl]-1,2,4-oxadiazol-5-yl]methanamine (CAS 1341130-08-2) is a chemical compound with the molecular formula C10H10BrN3O and a molecular weight of 268.11 g/mol. IUPAC name: [3-[(2-bromophenyl)methyl]-1,2,4-oxadiazol-5-yl]methanamine. InChIKey: GQQMTTRDVSRYNN-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN3O |
|---|---|
| Molecular weight | 268.11 g/mol |
| IUPAC name | [3-[(2-bromophenyl)methyl]-1,2,4-oxadiazol-5-yl]methanamine |
| InChIKey | GQQMTTRDVSRYNN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC2=NOC(=N2)CN)Br |
Computed by PubChem (NCBI)