CAS 1187385-88-1 is the registry number for 6-Fluoro-1-phenylbenzoimidazole, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
6-fluoro-1-phenylbenzimidazole (CAS 1187385-88-1) is a chemical compound with the molecular formula C13H9FN2 and a molecular weight of 212.22 g/mol. IUPAC name: 6-fluoro-1-phenylbenzimidazole. InChIKey: HOOBHOSUWSKTTL-UHFFFAOYSA-N.
| Molecular formula | C13H9FN2 |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | 6-fluoro-1-phenylbenzimidazole |
| InChIKey | HOOBHOSUWSKTTL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=NC3=C2C=C(C=C3)F |
Computed by PubChem (NCBI)