CAS 321-51-7 appears in our catalog under these names: 2-(2-Fluorophenyl)-1h-1,3-benzodiazole, 95%, 2-(2-fluorophenyl)-1H-1,3-benzodiazole, 97%(LC-MS),RG, 97%(LC-MS),RG. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 1g, 100mg, 250mg.
2-(2-fluorophenyl)-1H-benzimidazole (CAS 321-51-7) is a chemical compound with the molecular formula C13H9FN2 and a molecular weight of 212.22 g/mol. IUPAC name: 2-(2-fluorophenyl)-1H-benzimidazole. InChIKey: ASFACGIBGAEFHS-UHFFFAOYSA-N.
| Molecular formula | C13H9FN2 |
|---|---|
| Molecular weight | 212.22 g/mol |
| IUPAC name | 2-(2-fluorophenyl)-1H-benzimidazole |
| InChIKey | ASFACGIBGAEFHS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC3=CC=CC=C3N2)F |
Computed by PubChem (NCBI)