Products 1187386-02-2
CAS 1187386-02-2 is the registry number for tert-Butyl 4-(3-bromo-5-methylpyridin-2-yl)piperazine-1-carboxylate, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
Tert-butyl 4-(3-bromo-5-methyl-2-pyridinyl)piperazine-1-carboxylate (CAS 1187386-02-2) is a chemical compound with the molecular formula C15H22BrN3O2 and a molecular weight of 356.26 g/mol. IUPAC name: tert-butyl 4-(3-bromo-5-methyl-2-pyridinyl)piperazine-1-carboxylate. InChIKey: RTNRNZIQONRTPJ-UHFFFAOYSA-N.
| Molecular formula | C15H22BrN3O2 |
|---|---|
| Molecular weight | 356.26 g/mol |
| IUPAC name | tert-butyl 4-(3-bromo-5-methyl-2-pyridinyl)piperazine-1-carboxylate |
| InChIKey | RTNRNZIQONRTPJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1)N2CCN(CC2)C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)