Products 2206265-67-8
CAS 2206265-67-8 is the registry number for 5-Bromo-2-(4-methyl-piperazin-1-yl)-nicotinic acid tert-butyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl 5-bromo-2-(4-methylpiperazin-1-yl)pyridine-3-carboxylate (CAS 2206265-67-8) is a chemical compound with the molecular formula C15H22BrN3O2 and a molecular weight of 356.26 g/mol. IUPAC name: tert-butyl 5-bromo-2-(4-methylpiperazin-1-yl)pyridine-3-carboxylate. InChIKey: WZRYQPOYAAPKBQ-UHFFFAOYSA-N.
| Molecular formula | C15H22BrN3O2 |
|---|---|
| Molecular weight | 356.26 g/mol |
| IUPAC name | tert-butyl 5-bromo-2-(4-methylpiperazin-1-yl)pyridine-3-carboxylate |
| InChIKey | WZRYQPOYAAPKBQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(N=CC(=C1)Br)N2CCN(CC2)C |
Computed by PubChem (NCBI)