Products 328056-66-2
CAS 328056-66-2 is the registry number for 8-Fluoro-2,3,4,5-tetrahydro-1,5-methano-1H-3-benzazepine-7-carbonitrile. Offered by: TRC. Available pack sizes: 100mg.
5-fluoro-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene-4-carbonitrile (CAS 328056-66-2) is a chemical compound with the molecular formula C12H11FN2 and a molecular weight of 202.23 g/mol. IUPAC name: 5-fluoro-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene-4-carbonitrile. InChIKey: WCBQRCUGGGEXME-UHFFFAOYSA-N.
| Molecular formula | C12H11FN2 |
|---|---|
| Molecular weight | 202.23 g/mol |
| IUPAC name | 5-fluoro-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene-4-carbonitrile |
| InChIKey | WCBQRCUGGGEXME-UHFFFAOYSA-N |
| SMILES | C1C2CNCC1C3=C2C=C(C(=C3)F)C#N |
Computed by PubChem (NCBI)