CAS 1187386-29-3 is the registry number for Methyl 3-amino-2,6-dibromo-4-chlorobenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 500g, 100g, 5g, 1g.
Methyl 3-amino-2,6-dibromo-4-chlorobenzoate (CAS 1187386-29-3) is a chemical compound with the molecular formula C8H6Br2ClNO2 and a molecular weight of 343.40 g/mol. IUPAC name: methyl 3-amino-2,6-dibromo-4-chlorobenzoate. InChIKey: WCJCQMMPDRWOFL-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2ClNO2 |
|---|---|
| Molecular weight | 343.40 g/mol |
| IUPAC name | methyl 3-amino-2,6-dibromo-4-chlorobenzoate |
| InChIKey | WCJCQMMPDRWOFL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C(=C1Br)N)Cl)Br |
Computed by PubChem (NCBI)