CAS 1208077-26-2 is the registry number for Methyl 3-amino-2,4-dibromo-6-chlorobenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.
Methyl 3-amino-2,4-dibromo-6-chlorobenzoate (CAS 1208077-26-2) is a chemical compound with the molecular formula C8H6Br2ClNO2 and a molecular weight of 343.40 g/mol. IUPAC name: methyl 3-amino-2,4-dibromo-6-chlorobenzoate. InChIKey: DJKGCPPEJRZBKL-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2ClNO2 |
|---|---|
| Molecular weight | 343.40 g/mol |
| IUPAC name | methyl 3-amino-2,4-dibromo-6-chlorobenzoate |
| InChIKey | DJKGCPPEJRZBKL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1Cl)Br)N)Br |
Computed by PubChem (NCBI)