CAS 118757-04-3 is the registry number for 5-Bromo-1-(phenylsulfonyl)indoline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(benzenesulfonyl)-5-bromo-2,3-dihydroindole (CAS 118757-04-3) is a chemical compound with the molecular formula C14H12BrNO2S and a molecular weight of 338.22 g/mol. IUPAC name: 1-(benzenesulfonyl)-5-bromo-2,3-dihydroindole. InChIKey: KKMGBMHSUAXNOJ-UHFFFAOYSA-N.
| Molecular formula | C14H12BrNO2S |
|---|---|
| Molecular weight | 338.22 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-5-bromo-2,3-dihydroindole |
| InChIKey | KKMGBMHSUAXNOJ-UHFFFAOYSA-N |
| SMILES | C1CN(C2=C1C=C(C=C2)Br)S(=O)(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)