CAS 2390380-51-3 is the registry number for 2-Bromo-5-(4-methoxybenzyl)-5,6-dihydro-4H-thieno[2,3-c]pyrrol-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5-[(4-methoxyphenyl)methyl]-6H-thieno[2,3-c]pyrrol-4-one (CAS 2390380-51-3) is a chemical compound with the molecular formula C14H12BrNO2S and a molecular weight of 338.22 g/mol. IUPAC name: 2-bromo-5-[(4-methoxyphenyl)methyl]-6H-thieno[2,3-c]pyrrol-4-one. InChIKey: RFYUXSDBLUXNBI-UHFFFAOYSA-N.
| Molecular formula | C14H12BrNO2S |
|---|---|
| Molecular weight | 338.22 g/mol |
| IUPAC name | 2-bromo-5-[(4-methoxyphenyl)methyl]-6H-thieno[2,3-c]pyrrol-4-one |
| InChIKey | RFYUXSDBLUXNBI-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2CC3=C(C2=O)C=C(S3)Br |
Computed by PubChem (NCBI)