Products 1187669-52-8
CAS 1187669-52-8 is the registry number for 2-Bromo-1-(3-chloropyridin-4-yl)ethan-1-one hydrobromide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-bromo-1-(3-chloro-4-pyridinyl)ethanone;hydrobromide (CAS 1187669-52-8) is a chemical compound with the molecular formula C7H6Br2ClNO and a molecular weight of 315.39 g/mol. IUPAC name: 2-bromo-1-(3-chloro-4-pyridinyl)ethanone;hydrobromide. InChIKey: AWYKAVOVCORZHA-UHFFFAOYSA-N.
| Molecular formula | C7H6Br2ClNO |
|---|---|
| Molecular weight | 315.39 g/mol |
| IUPAC name | 2-bromo-1-(3-chloro-4-pyridinyl)ethanone;hydrobromide |
| InChIKey | AWYKAVOVCORZHA-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C(=O)CBr)Cl.Br |
Computed by PubChem (NCBI)