Products 860586-90-9
CAS 860586-90-9 appears in our catalog under these names: 2,4-Dibromo-3-chloro-6-methoxyaniline, 95+%, 3-Chloro-2,4-dibromo-6-methoxyaniline, 98.0%. Offered by: AmBeed, Fluorochem. Available pack sizes: 1g, 5g.
2,4-dibromo-3-chloro-6-methoxyaniline (CAS 860586-90-9) is a chemical compound with the molecular formula C7H6Br2ClNO and a molecular weight of 315.39 g/mol. IUPAC name: 2,4-dibromo-3-chloro-6-methoxyaniline. InChIKey: CBPGXLBNTZFGEO-UHFFFAOYSA-N.
| Molecular formula | C7H6Br2ClNO |
|---|---|
| Molecular weight | 315.39 g/mol |
| IUPAC name | 2,4-dibromo-3-chloro-6-methoxyaniline |
| InChIKey | CBPGXLBNTZFGEO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1N)Br)Cl)Br |
Computed by PubChem (NCBI)