CAS 1187830-55-2 appears in our catalog under these names: 2-(2-(4-Chlorophenyl)thiazol-4-yl)ethanamine hydrochloride, 95%, 2–(2–(4–Chlorophenyl)thiazol–4–yl)ethan–1–amine hydrochloride, 2-(2-(4-Chlorophenyl)thiazol-4-yl)ethanamine hcl, 95%, 95%, 2-(2-(4-Chlorophenyl)thiazol-4-yl)ethan-1-amine hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]ethanamine;hydrochloride (CAS 1187830-55-2) is a chemical compound with the molecular formula C11H12Cl2N2S and a molecular weight of 275.2 g/mol. IUPAC name: 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]ethanamine;hydrochloride. InChIKey: GTOIEICHKUIVPM-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2S |
|---|---|
| Molecular weight | 275.2 g/mol |
| IUPAC name | 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]ethanamine;hydrochloride |
| InChIKey | GTOIEICHKUIVPM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CS2)CCN)Cl.Cl |
Computed by PubChem (NCBI)