CAS 33188-18-0 appears in our catalog under these names: 4-(Chloromethyl)-n-(4-methylphenyl)-1,3-thiazol-2-amine hydrochloride, 95%, 4-(Chloromethyl)-N-(p-tolyl)thiazol-2-amine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 5g, 1g.
4-(chloromethyl)-N-(4-methylphenyl)-1,3-thiazol-2-amine;hydrochloride (CAS 33188-18-0) is a chemical compound with the molecular formula C11H12Cl2N2S and a molecular weight of 275.2 g/mol. IUPAC name: 4-(chloromethyl)-N-(4-methylphenyl)-1,3-thiazol-2-amine;hydrochloride. InChIKey: JSHQPMPGROKHOC-UHFFFAOYSA-N.
| Molecular formula | C11H12Cl2N2S |
|---|---|
| Molecular weight | 275.2 g/mol |
| IUPAC name | 4-(chloromethyl)-N-(4-methylphenyl)-1,3-thiazol-2-amine;hydrochloride |
| InChIKey | JSHQPMPGROKHOC-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=NC(=CS2)CCl.Cl |
Computed by PubChem (NCBI)