CAS 1187830-69-8 is the registry number for 2-Benzylisoindolin-5-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-benzyl-1,3-dihydroisoindol-5-amine;hydrochloride (CAS 1187830-69-8) is a chemical compound with the molecular formula C15H17ClN2 and a molecular weight of 260.76 g/mol. IUPAC name: 2-benzyl-1,3-dihydroisoindol-5-amine;hydrochloride. InChIKey: IFRFKKYENZQFKR-UHFFFAOYSA-N.
| Molecular formula | C15H17ClN2 |
|---|---|
| Molecular weight | 260.76 g/mol |
| IUPAC name | 2-benzyl-1,3-dihydroisoindol-5-amine;hydrochloride |
| InChIKey | IFRFKKYENZQFKR-UHFFFAOYSA-N |
| SMILES | C1C2=C(CN1CC3=CC=CC=C3)C=C(C=C2)N.Cl |
Computed by PubChem (NCBI)