CAS 1210277-79-4 appears in our catalog under these names: 1-Benzyl-2,3-dihydro-1H-indol-5-amine hydrochloride, 95%, 1-Benzyl-2,3-dihydro-1H-indol-5-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 0,5g, 50mg.
1-benzyl-2,3-dihydroindol-5-amine;hydrochloride (CAS 1210277-79-4) is a chemical compound with the molecular formula C15H17ClN2 and a molecular weight of 260.76 g/mol. IUPAC name: 1-benzyl-2,3-dihydroindol-5-amine;hydrochloride. InChIKey: ZSISKMLHMPXRLP-UHFFFAOYSA-N.
| Molecular formula | C15H17ClN2 |
|---|---|
| Molecular weight | 260.76 g/mol |
| IUPAC name | 1-benzyl-2,3-dihydroindol-5-amine;hydrochloride |
| InChIKey | ZSISKMLHMPXRLP-UHFFFAOYSA-N |
| SMILES | C1CN(C2=C1C=C(C=C2)N)CC3=CC=CC=C3.Cl |
Computed by PubChem (NCBI)