Products 1187861-76-2
CAS 1187861-76-2 is the registry number for 5-Amino-N,N,3-trimethyl-1H-pyrazole-4-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-amino-N,N,5-trimethyl-1H-pyrazole-4-carboxamide (CAS 1187861-76-2) is a chemical compound with the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. IUPAC name: 3-amino-N,N,5-trimethyl-1H-pyrazole-4-carboxamide. InChIKey: OHGWXNZBYWAEOC-UHFFFAOYSA-N.
| Molecular formula | C7H12N4O |
|---|---|
| Molecular weight | 168.20 g/mol |
| IUPAC name | 3-amino-N,N,5-trimethyl-1H-pyrazole-4-carboxamide |
| InChIKey | OHGWXNZBYWAEOC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)N)C(=O)N(C)C |
Computed by PubChem (NCBI)