CAS 1187927-50-9 is the registry number for Isoxazol-4-ylmethanamine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
Oxalic acid;1,2-oxazol-4-ylmethanamine (CAS 1187927-50-9) is a chemical compound with the molecular formula C6H8N2O5 and a molecular weight of 188.14 g/mol. IUPAC name: oxalic acid;1,2-oxazol-4-ylmethanamine. InChIKey: DTCNQHCIGAYABF-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O5 |
|---|---|
| Molecular weight | 188.14 g/mol |
| IUPAC name | oxalic acid;1,2-oxazol-4-ylmethanamine |
| InChIKey | DTCNQHCIGAYABF-UHFFFAOYSA-N |
| SMILES | C1=C(C=NO1)CN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)