Products 1187927-50-9

CAS 1187927-50-9 is the registry number for Isoxazol-4-ylmethanamine oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.

Structural formula: {0} (CAS {1})

Oxalic acid;1,2-oxazol-4-ylmethanamine (CAS 1187927-50-9) is a chemical compound with the molecular formula C6H8N2O5 and a molecular weight of 188.14 g/mol. IUPAC name: oxalic acid;1,2-oxazol-4-ylmethanamine. InChIKey: DTCNQHCIGAYABF-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8N2O5
Molecular weight188.14 g/mol
IUPAC nameoxalic acid;1,2-oxazol-4-ylmethanamine
InChIKeyDTCNQHCIGAYABF-UHFFFAOYSA-N
SMILESC1=C(C=NO1)CN.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)