CAS 943418-43-7 appears in our catalog under these names: rac N-Formiminoglutamic Acid, >95% (HPLC), 2-(2-Formylhydrazinylidene)-pentanedioic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g.
2-(formyldiazenyl)pentanedioic acid (CAS 943418-43-7) is a chemical compound with the molecular formula C6H8N2O5 and a molecular weight of 188.14 g/mol. IUPAC name: 2-(formyldiazenyl)pentanedioic acid. InChIKey: ZMMIQVLVCFMWDD-UHFFFAOYSA-N.
| Molecular formula | C6H8N2O5 |
|---|---|
| Molecular weight | 188.14 g/mol |
| IUPAC name | 2-(formyldiazenyl)pentanedioic acid |
| InChIKey | ZMMIQVLVCFMWDD-UHFFFAOYSA-N |
| SMILES | C(CC(=O)O)C(C(=O)O)N=NC=O |
Computed by PubChem (NCBI)