CAS 1187929-52-7 appears in our catalog under these names: 5-Chloro-2-fluoro-benzamidine hydrochloride, 95%, 5-Chloro-2-fluorobenzimidamide hydrochloride 97%, 5-Chloro-2-fluoro-benzamidine, HCl, 97%, 97%, 5-Chloro-2-fluorobenzimidamide hydrochloride, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g.
5-chloro-2-fluorobenzenecarboximidamide;hydrochloride (CAS 1187929-52-7) is a chemical compound with the molecular formula C7H7Cl2FN2 and a molecular weight of 209.05 g/mol. IUPAC name: 5-chloro-2-fluorobenzenecarboximidamide;hydrochloride. InChIKey: CAQAESKTXCBUDE-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2FN2 |
|---|---|
| Molecular weight | 209.05 g/mol |
| IUPAC name | 5-chloro-2-fluorobenzenecarboximidamide;hydrochloride |
| InChIKey | CAQAESKTXCBUDE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=N)N)F.Cl |
Computed by PubChem (NCBI)