Products 1379294-39-9
CAS 1379294-39-9 is the registry number for 4,6-Dichloro-5-fluoro-2-isopropylpyrimidine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4,6-dichloro-5-fluoro-2-propan-2-ylpyrimidine (CAS 1379294-39-9) is a chemical compound with the molecular formula C7H7Cl2FN2 and a molecular weight of 209.05 g/mol. IUPAC name: 4,6-dichloro-5-fluoro-2-propan-2-ylpyrimidine. InChIKey: CEXQVJMMOGOAQZ-UHFFFAOYSA-N.
| Molecular formula | C7H7Cl2FN2 |
|---|---|
| Molecular weight | 209.05 g/mol |
| IUPAC name | 4,6-dichloro-5-fluoro-2-propan-2-ylpyrimidine |
| InChIKey | CEXQVJMMOGOAQZ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=C(C(=N1)Cl)F)Cl |
Computed by PubChem (NCBI)