Products 1187930-62-6
CAS 1187930-62-6 is the registry number for TERT-BUTYL 2-(4-(2-AMINOETHYL)PHENYL)ACETATE OXALATE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl 2-[4-(2-aminoethyl)phenyl]acetate;oxalic acid (CAS 1187930-62-6) is a chemical compound with the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. IUPAC name: tert-butyl 2-[4-(2-aminoethyl)phenyl]acetate;oxalic acid. InChIKey: ZMFOEEVRFPJUKX-UHFFFAOYSA-N.
| Molecular formula | C16H23NO6 |
|---|---|
| Molecular weight | 325.36 g/mol |
| IUPAC name | tert-butyl 2-[4-(2-aminoethyl)phenyl]acetate;oxalic acid |
| InChIKey | ZMFOEEVRFPJUKX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CC1=CC=C(C=C1)CCN.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)