Products 1951440-84-8

CAS 1951440-84-8 is the registry number for 2-(3-Methoxy-benzyloxy)-cyclohexylamine oxalate, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-[(3-methoxyphenyl)methoxy]cyclohexan-1-amine;oxalic acid (CAS 1951440-84-8) is a chemical compound with the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. IUPAC name: 2-[(3-methoxyphenyl)methoxy]cyclohexan-1-amine;oxalic acid. InChIKey: LBMZUVODFLIWPH-UHFFFAOYSA-N.

Identity
Molecular formulaC16H23NO6
Molecular weight325.36 g/mol
IUPAC name2-[(3-methoxyphenyl)methoxy]cyclohexan-1-amine;oxalic acid
InChIKeyLBMZUVODFLIWPH-UHFFFAOYSA-N
SMILESCOC1=CC=CC(=C1)COC2CCCCC2N.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)