CAS 1187931-73-2 is the registry number for 3-Aminomethyl-1,3-dihydro-indol-2-one hydrochloride. Offered by: Biosynth. Available pack sizes: 500mg.
3-(aminomethyl)-1,3-dihydroindol-2-one;hydrochloride (CAS 1187931-73-2) is a chemical compound with the molecular formula C9H11ClN2O and a molecular weight of 198.65 g/mol. IUPAC name: 3-(aminomethyl)-1,3-dihydroindol-2-one;hydrochloride. InChIKey: SDLHOHZRTWIODW-UHFFFAOYSA-N.
| Molecular formula | C9H11ClN2O |
|---|---|
| Molecular weight | 198.65 g/mol |
| IUPAC name | 3-(aminomethyl)-1,3-dihydroindol-2-one;hydrochloride |
| InChIKey | SDLHOHZRTWIODW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C(=O)N2)CN.Cl |
Computed by PubChem (NCBI)