CAS 1187931-76-5 appears in our catalog under these names: (S)-tert-Butyl 3-(cyanomethyl)pyrrolidine-1-carboxylate, 95%, (S)–tert–Butyl 3–(cyanomethyl)pyrrolidine–1–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
Tert-butyl (3S)-3-(cyanomethyl)pyrrolidine-1-carboxylate (CAS 1187931-76-5) is a chemical compound with the molecular formula C11H18N2O2 and a molecular weight of 210.27 g/mol. IUPAC name: tert-butyl (3S)-3-(cyanomethyl)pyrrolidine-1-carboxylate. InChIKey: IPLBXZOFLWOERN-SECBINFHSA-N.
| Molecular formula | C11H18N2O2 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | tert-butyl (3S)-3-(cyanomethyl)pyrrolidine-1-carboxylate |
| InChIKey | IPLBXZOFLWOERN-SECBINFHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C1)CC#N |
Computed by PubChem (NCBI)