Products 1187966-93-3
CAS 1187966-93-3 appears in our catalog under these names: Pitavastatin Impurity 39, (3R,5S)-5-(6-Cyclopropyl-10-fluorobenzo(k)phenanthridin-8-yl)-3,5-dihydroxypentanoic Acid. Offered by: Hubei YoungXin, TRC. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 0,5mg, 1mg, 5mg.
(3R,5S)-5-(6-cyclopropyl-10-fluorobenzo[k]phenanthridin-8-yl)-3,5-dihydroxypentanoic acid (CAS 1187966-93-3) is a chemical compound with the molecular formula C25H22FNO4 and a molecular weight of 419.4 g/mol. IUPAC name: (3R,5S)-5-(6-cyclopropyl-10-fluorobenzo[k]phenanthridin-8-yl)-3,5-dihydroxypentanoic acid. InChIKey: JEAIZQYPWPSXQH-QRQCRPRQSA-N.
| Molecular formula | C25H22FNO4 |
|---|---|
| Molecular weight | 419.4 g/mol |
| IUPAC name | (3R,5S)-5-(6-cyclopropyl-10-fluorobenzo[k]phenanthridin-8-yl)-3,5-dihydroxypentanoic acid |
| InChIKey | JEAIZQYPWPSXQH-QRQCRPRQSA-N |
| SMILES | C1CC1C2=NC3=CC=CC=C3C4=C5C=CC(=CC5=C(C=C24)[C@H](C[C@H](CC(=O)O)O)O)F |
Computed by PubChem (NCBI)