CAS 331763-63-4 appears in our catalog under these names: Fmoc-(r)-3-amino-4-(2-fluoro-phenyl)-butyric acid, 95%, (R)–3–(Fmoc–amino)–4–(2–fluorophenyl)butanoic acid, (R)-3-(Fmoc-amino)-4-(2-fluorophenyl)butanoic acid, 96%, 96%, Fmoc-(R)-3-Amino-4-(2-fluoro-phenyl)-butyric acid, 96%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
(3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(2-fluorophenyl)butanoic acid (CAS 331763-63-4) is a chemical compound with the molecular formula C25H22FNO4 and a molecular weight of 419.4 g/mol. IUPAC name: (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(2-fluorophenyl)butanoic acid. InChIKey: QGZZXPYYCHIOHR-QGZVFWFLSA-N.
| Molecular formula | C25H22FNO4 |
|---|---|
| Molecular weight | 419.4 g/mol |
| IUPAC name | (3R)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-(2-fluorophenyl)butanoic acid |
| InChIKey | QGZZXPYYCHIOHR-QGZVFWFLSA-N |
| SMILES | C1=CC=C(C(=C1)C[C@H](CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)F |
Computed by PubChem (NCBI)