CAS 1217777-84-8 appears in our catalog under these names: Fmoc-alpha-methyl-d-4-fluorophenylalanine, 95%, Fmoc–4–fluoro–α–Me–D–Phe–OH ·DCHA. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-fluorophenyl)-2-methylpropanoic acid (CAS 1217777-84-8) is a chemical compound with the molecular formula C25H22FNO4 and a molecular weight of 419.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-fluorophenyl)-2-methylpropanoic acid. InChIKey: HGCDIHMFXNGCRG-RUZDIDTESA-N.
| Molecular formula | C25H22FNO4 |
|---|---|
| Molecular weight | 419.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(4-fluorophenyl)-2-methylpropanoic acid |
| InChIKey | HGCDIHMFXNGCRG-RUZDIDTESA-N |
| SMILES | C[C@@](CC1=CC=C(C=C1)F)(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)