CAS 118802-45-2 is the registry number for 2-Hydrazinyl-5,6,7,8-tetrahydroquinazolin-4-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-hydrazinyl-5,6,7,8-tetrahydro-3H-quinazolin-4-one (CAS 118802-45-2) is a chemical compound with the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. IUPAC name: 2-hydrazinyl-5,6,7,8-tetrahydro-3H-quinazolin-4-one. InChIKey: YYNKPUBLXZGSLR-UHFFFAOYSA-N.
| Molecular formula | C8H12N4O |
|---|---|
| Molecular weight | 180.21 g/mol |
| IUPAC name | 2-hydrazinyl-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
| InChIKey | YYNKPUBLXZGSLR-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C(=O)NC(=N2)NN |
Computed by PubChem (NCBI)