Products 1188093-74-4
CAS 1188093-74-4 is the registry number for 2-(4-Fluorophenyl)-4,6-dimethylpyrimidine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(4-fluorophenyl)-4,6-dimethylpyrimidine (CAS 1188093-74-4) is a chemical compound with the molecular formula C12H11FN2 and a molecular weight of 202.23 g/mol. IUPAC name: 2-(4-fluorophenyl)-4,6-dimethylpyrimidine. InChIKey: KSUHXEKDCOGHLJ-UHFFFAOYSA-N.
| Molecular formula | C12H11FN2 |
|---|---|
| Molecular weight | 202.23 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-4,6-dimethylpyrimidine |
| InChIKey | KSUHXEKDCOGHLJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)C2=CC=C(C=C2)F)C |
Computed by PubChem (NCBI)