CAS 1188094-04-3 is the registry number for 4,6-Dichloro-2-(chloromethyl)benzo[d]thiazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4,6-dichloro-2-(chloromethyl)-1,3-benzothiazole (CAS 1188094-04-3) is a chemical compound with the molecular formula C8H4Cl3NS and a molecular weight of 252.5 g/mol. IUPAC name: 4,6-dichloro-2-(chloromethyl)-1,3-benzothiazole. InChIKey: MQILKGVFBFSZBE-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl3NS |
|---|---|
| Molecular weight | 252.5 g/mol |
| IUPAC name | 4,6-dichloro-2-(chloromethyl)-1,3-benzothiazole |
| InChIKey | MQILKGVFBFSZBE-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1SC(=N2)CCl)Cl)Cl |
Computed by PubChem (NCBI)