CAS 1245031-40-6 is the registry number for 6,7-Dichloro-2-(chloromethyl)benzo[d]thiazole, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dichloro-2-(chloromethyl)-1,3-benzothiazole (CAS 1245031-40-6) is a chemical compound with the molecular formula C8H4Cl3NS and a molecular weight of 252.5 g/mol. IUPAC name: 6,7-dichloro-2-(chloromethyl)-1,3-benzothiazole. InChIKey: CGVFHMRRAIKJSO-UHFFFAOYSA-N.
| Molecular formula | C8H4Cl3NS |
|---|---|
| Molecular weight | 252.5 g/mol |
| IUPAC name | 6,7-dichloro-2-(chloromethyl)-1,3-benzothiazole |
| InChIKey | CGVFHMRRAIKJSO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1N=C(S2)CCl)Cl)Cl |
Computed by PubChem (NCBI)