CAS 1188169-75-6 is the registry number for 4-Bromo-2,2-dimethyl-2,3-dihydro-1H-inden-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-2,2-dimethyl-1,3-dihydroinden-1-ol (CAS 1188169-75-6) is a chemical compound with the molecular formula C11H13BrO and a molecular weight of 241.12 g/mol. IUPAC name: 4-bromo-2,2-dimethyl-1,3-dihydroinden-1-ol. InChIKey: POYWOCRGHQMVBA-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO |
|---|---|
| Molecular weight | 241.12 g/mol |
| IUPAC name | 4-bromo-2,2-dimethyl-1,3-dihydroinden-1-ol |
| InChIKey | POYWOCRGHQMVBA-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(C1O)C=CC=C2Br)C |
Computed by PubChem (NCBI)