CAS 1188233-15-9 appears in our catalog under these names: (6-Bromobenzo(d)thiazol-2-yl)methanol, 95+%, (6-Bromo-1,3-benzothiazol-2-yl)methanol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(6-bromo-1,3-benzothiazol-2-yl)methanol (CAS 1188233-15-9) is a chemical compound with the molecular formula C8H6BrNOS and a molecular weight of 244.11 g/mol. IUPAC name: (6-bromo-1,3-benzothiazol-2-yl)methanol. InChIKey: JBLBHKPUSANPJP-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNOS |
|---|---|
| Molecular weight | 244.11 g/mol |
| IUPAC name | (6-bromo-1,3-benzothiazol-2-yl)methanol |
| InChIKey | JBLBHKPUSANPJP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)SC(=N2)CO |
Computed by PubChem (NCBI)