Products 1188543-27-2

CAS 1188543-27-2 is the registry number for 1-(tert-Butyl) 2-methyl 4-methylenepyrrolidine-1,2-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

1-O-tert-butyl 2-O-methyl 4-methylidenepyrrolidine-1,2-dicarboxylate (CAS 1188543-27-2) is a chemical compound with the molecular formula C12H19NO4 and a molecular weight of 241.28 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl 4-methylidenepyrrolidine-1,2-dicarboxylate. InChIKey: CEEDNDKFZGTXOZ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H19NO4
Molecular weight241.28 g/mol
IUPAC name1-O-tert-butyl 2-O-methyl 4-methylidenepyrrolidine-1,2-dicarboxylate
InChIKeyCEEDNDKFZGTXOZ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CC(=C)CC1C(=O)OC

Computed by PubChem (NCBI)