Products 1189105-40-5
CAS 1189105-40-5 is the registry number for Denudaquinol. Offered by: MedChemExpress. Available pack sizes: Get quote.
Methyl 2-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,5-dihydroxyphenyl]acetate (CAS 1189105-40-5) is a chemical compound with the molecular formula C19H26O4 and a molecular weight of 318.4 g/mol. IUPAC name: methyl 2-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,5-dihydroxyphenyl]acetate. InChIKey: FJFOYRHXOZSRFV-RIYZIHGNSA-N.
| Molecular formula | C19H26O4 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | methyl 2-[3-[(2E)-3,7-dimethylocta-2,6-dienyl]-2,5-dihydroxyphenyl]acetate |
| InChIKey | FJFOYRHXOZSRFV-RIYZIHGNSA-N |
| SMILES | CC(=CCC/C(=C/CC1=C(C(=CC(=C1)O)CC(=O)OC)O)/C)C |
Computed by PubChem (NCBI)