Products 123999-38-2
CAS 123999-38-2 is the registry number for 2,4-Dihydroxy-6-methoxy-3,5-diprenylacetophenone. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-[2,4-dihydroxy-6-methoxy-3,5-bis(3-methylbut-2-enyl)phenyl]ethanone (CAS 123999-38-2) is a chemical compound with the molecular formula C19H26O4 and a molecular weight of 318.4 g/mol. IUPAC name: 1-[2,4-dihydroxy-6-methoxy-3,5-bis(3-methylbut-2-enyl)phenyl]ethanone. InChIKey: XRXYLECRPIOJBW-UHFFFAOYSA-N.
| Molecular formula | C19H26O4 |
|---|---|
| Molecular weight | 318.4 g/mol |
| IUPAC name | 1-[2,4-dihydroxy-6-methoxy-3,5-bis(3-methylbut-2-enyl)phenyl]ethanone |
| InChIKey | XRXYLECRPIOJBW-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C(=C(C(=C1O)C(=O)C)OC)CC=C(C)C)O)C |
Computed by PubChem (NCBI)