Products 1189106-86-2
CAS 1189106-86-2 is the registry number for 4-Bromo-6,8-difluoro-2-methylquinoline, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 50mg.
4-bromo-6,8-difluoro-2-methylquinoline (CAS 1189106-86-2) is a chemical compound with the molecular formula C10H6BrF2N and a molecular weight of 258.06 g/mol. IUPAC name: 4-bromo-6,8-difluoro-2-methylquinoline. InChIKey: BMDJTKNFPQFHEW-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF2N |
|---|---|
| Molecular weight | 258.06 g/mol |
| IUPAC name | 4-bromo-6,8-difluoro-2-methylquinoline |
| InChIKey | BMDJTKNFPQFHEW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C=C(C=C(C2=N1)F)F)Br |
Computed by PubChem (NCBI)