CAS 1695620-99-5 is the registry number for 2-Bromo-5,8-difluoro-6-methylquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5,8-difluoro-6-methylquinoline (CAS 1695620-99-5) is a chemical compound with the molecular formula C10H6BrF2N and a molecular weight of 258.06 g/mol. IUPAC name: 2-bromo-5,8-difluoro-6-methylquinoline. InChIKey: HQGRCLNJAZQWAD-UHFFFAOYSA-N.
| Molecular formula | C10H6BrF2N |
|---|---|
| Molecular weight | 258.06 g/mol |
| IUPAC name | 2-bromo-5,8-difluoro-6-methylquinoline |
| InChIKey | HQGRCLNJAZQWAD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1F)C=CC(=N2)Br)F |
Computed by PubChem (NCBI)