CAS 118918-76-6 appears in our catalog under these names: (3S,7Ar)-3-phenyltetrahydropyrrolo[1,2-c]oxazol-5(3h)-one, 95%, (3S,7AR)-3-phenyltetrahydropyrrolo(1,2-c)oxazol-5(3H)-one, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
(3S,7aR)-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (CAS 118918-76-6) is a chemical compound with the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. IUPAC name: (3S,7aR)-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one. InChIKey: OURKKNDNLSPPQY-PWSUYJOCSA-N.
| Molecular formula | C12H13NO2 |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | (3S,7aR)-3-phenyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| InChIKey | OURKKNDNLSPPQY-PWSUYJOCSA-N |
| SMILES | C1CC(=O)N2[C@H]1CO[C@H]2C3=CC=CC=C3 |
Computed by PubChem (NCBI)