Products 118923-96-9
CAS 118923-96-9 is the registry number for 1-Chloro-2-isocyano-3-methylbenzene, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-2-isocyano-3-methylbenzene (CAS 118923-96-9) is a chemical compound with the molecular formula C8H6ClN and a molecular weight of 151.59 g/mol. IUPAC name: 1-chloro-2-isocyano-3-methylbenzene. InChIKey: FUJFVLJRBCVMHT-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN |
|---|---|
| Molecular weight | 151.59 g/mol |
| IUPAC name | 1-chloro-2-isocyano-3-methylbenzene |
| InChIKey | FUJFVLJRBCVMHT-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)Cl)[N+]#[C-] |
Computed by PubChem (NCBI)