CAS 39546-47-9 appears in our catalog under these names: 4-Chlorobenzylisocyanide, 95%, 1-Chloro-4-(isocyanomethyl)benzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 100mg, 0,5g, 50mg.
1-chloro-4-(isocyanomethyl)benzene (CAS 39546-47-9) is a chemical compound with the molecular formula C8H6ClN and a molecular weight of 151.59 g/mol. IUPAC name: 1-chloro-4-(isocyanomethyl)benzene. InChIKey: UNRNSTIWJVLLMX-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN |
|---|---|
| Molecular weight | 151.59 g/mol |
| IUPAC name | 1-chloro-4-(isocyanomethyl)benzene |
| InChIKey | UNRNSTIWJVLLMX-UHFFFAOYSA-N |
| SMILES | [C-]#[N+]CC1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)