Products 1189377-77-2
CAS 1189377-77-2 is the registry number for 1,2-Bis(4-(Pyridin-4-Yl)Phenyl)Ethyne, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-[4-[2-(4-pyridin-4-ylphenyl)ethynyl]phenyl]pyridine (CAS 1189377-77-2) is a chemical compound with the molecular formula C24H16N2 and a molecular weight of 332.4 g/mol. IUPAC name: 4-[4-[2-(4-pyridin-4-ylphenyl)ethynyl]phenyl]pyridine. InChIKey: GOPOAAAAUVXGJK-UHFFFAOYSA-N.
| Molecular formula | C24H16N2 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 4-[4-[2-(4-pyridin-4-ylphenyl)ethynyl]phenyl]pyridine |
| InChIKey | GOPOAAAAUVXGJK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#CC2=CC=C(C=C2)C3=CC=NC=C3)C4=CC=NC=C4 |
Computed by PubChem (NCBI)