Products 1189426-25-2
CAS 1189426-25-2 is the registry number for Alpha-Phenyl-2-piperidineacetamide-d10 (Mixture of Diastereomers). Offered by: TRC. Available pack sizes: 10mg, 1mg.
2-deuterio-2-(2,3,3,4,4,5,5,6,6-nonadeuteriopiperidin-2-yl)-2-phenylacetamide (CAS 1189426-25-2) is a chemical compound with the molecular formula C13H18N2O and a molecular weight of 228.36 g/mol. IUPAC name: 2-deuterio-2-(2,3,3,4,4,5,5,6,6-nonadeuteriopiperidin-2-yl)-2-phenylacetamide. InChIKey: LJLMNWPXAYKPGV-KKRRWKDRSA-N.
| Molecular formula | C13H18N2O |
|---|---|
| Molecular weight | 228.36 g/mol |
| IUPAC name | 2-deuterio-2-(2,3,3,4,4,5,5,6,6-nonadeuteriopiperidin-2-yl)-2-phenylacetamide |
| InChIKey | LJLMNWPXAYKPGV-KKRRWKDRSA-N |
| SMILES | [2H]C1(C(C(NC(C1([2H])[2H])([2H])C([2H])(C2=CC=CC=C2)C(=O)N)([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)