CAS 50288-62-5 appears in our catalog under these names: Methylphenidate hydrochloride Impurity 13, (D,L)-threo-alpha-Phenyl-2-piperidineacetamide, >95% (HPLC), (2RS)-2-Phenyl-2-((2RS)-piperidin-2-yl)acetamide. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 250mg, 25mg.
(2R)-2-phenyl-2-[(2R)-piperidin-2-yl]acetamide (CAS 50288-62-5) is a chemical compound with the molecular formula C13H18N2O and a molecular weight of 218.29 g/mol. IUPAC name: (2R)-2-phenyl-2-[(2R)-piperidin-2-yl]acetamide. InChIKey: LJLMNWPXAYKPGV-VXGBXAGGSA-N.
| Molecular formula | C13H18N2O |
|---|---|
| Molecular weight | 218.29 g/mol |
| IUPAC name | (2R)-2-phenyl-2-[(2R)-piperidin-2-yl]acetamide |
| InChIKey | LJLMNWPXAYKPGV-VXGBXAGGSA-N |
| SMILES | C1CCN[C@H](C1)[C@@H](C2=CC=CC=C2)C(=O)N |
Computed by PubChem (NCBI)