CAS 1189428-23-6 appears in our catalog under these names: Valdecoxib-13C2,15N, 98% 98%atom%13C,98%atom%15N, Valdecoxib-13C2,15N, >95% (HPLC), Valdecoxib-13C2,15N. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 10 mg, 1 mg.
4-(5-(113C)methyl-3-phenyl-(513C,215N)1,2-oxazol-4-yl)benzenesulfonamide (CAS 1189428-23-6) is a chemical compound with the molecular formula C16H14N2O3S and a molecular weight of 317.34 g/mol. IUPAC name: 4-(5-(113C)methyl-3-phenyl-(513C,215N)1,2-oxazol-4-yl)benzenesulfonamide. InChIKey: LNPDTQAFDNKSHK-LQFUBYOBSA-N.
| Molecular formula | C16H14N2O3S |
|---|---|
| Molecular weight | 317.34 g/mol |
| IUPAC name | 4-(5-(113C)methyl-3-phenyl-(513C,215N)1,2-oxazol-4-yl)benzenesulfonamide |
| InChIKey | LNPDTQAFDNKSHK-LQFUBYOBSA-N |
| SMILES | [13CH3][13C]1=C(C(=[15N]O1)C2=CC=CC=C2)C3=CC=C(C=C3)S(=O)(=O)N |
Computed by PubChem (NCBI)