CAS 2304623-37-6 is the registry number for Parecoxib Sodium Impurity 59. Offered by: Chemat Brand. Available pack sizes: on request.
2-(5-methyl-4-phenyl-1,2-oxazol-3-yl)benzenesulfonamide (CAS 2304623-37-6) is a chemical compound with the molecular formula C16H14N2O3S and a molecular weight of 314.4 g/mol. IUPAC name: 2-(5-methyl-4-phenyl-1,2-oxazol-3-yl)benzenesulfonamide. InChIKey: VUWHZMZLDNCOHR-UHFFFAOYSA-N.
| Molecular formula | C16H14N2O3S |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 2-(5-methyl-4-phenyl-1,2-oxazol-3-yl)benzenesulfonamide |
| InChIKey | VUWHZMZLDNCOHR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NO1)C2=CC=CC=C2S(=O)(=O)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)