Products 1189436-83-6
CAS 1189436-83-6 appears in our catalog under these names: N-Boc-N-methylpiperazine-d8, tert-Butyl 4-methylpiperazine-1-carboxylate-d8. Offered by: TRC, MedChemExpress. Available pack sizes: 50mg, 5mg, 5 mg, 50 mg.
Tert-butyl 2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazine-1-carboxylate (CAS 1189436-83-6) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 208.33 g/mol. IUPAC name: tert-butyl 2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazine-1-carboxylate. InChIKey: CJDYFMIDIQXELO-YEBVBAJPSA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 208.33 g/mol |
| IUPAC name | tert-butyl 2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazine-1-carboxylate |
| InChIKey | CJDYFMIDIQXELO-YEBVBAJPSA-N |
| SMILES | [2H]C1(C(N(C(C(N1C)([2H])[2H])([2H])[2H])C(=O)OC(C)(C)C)([2H])[2H])[2H] |
Computed by PubChem (NCBI)